C17H21N3O2S2 — CID 100736023
1-(6-methyl-2-pyridinyl)-3-[(1S)-1-(4-methylsulfonylphenyl)propyl]thiourea (PubChem CID 100736023) has the molecular formula C17H21N3O2S2 and a molecular weight of 363.51 g/mol. Its IUPAC name is 1-(6-methyl-2-pyridinyl)-3-[(1S)-1-(4-methylsulfonylphenyl)propyl]thiourea.
| Compound Name | 1-(6-methyl-2-pyridinyl)-3-[(1S)-1-(4-methylsulfonylphenyl)propyl]thiourea |
|---|---|
| PubChem CID | 100736023 |
| Molecular Formula | C17H21N3O2S2 |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | 1-(6-methyl-2-pyridinyl)-3-[(1S)-1-(4-methylsulfonylphenyl)propyl]thiourea |
| SMILES | CC[C@H](NC(=S)Nc1cccc(C)n1)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C17H21N3O2S2/c1-4-15(13-8-10-14(11-9-13)24(3,21)22)19-17(23)20-16-7-5-6-12(2)18-16/h5-11,15H,4H2,1-3H3,(H2,18,19,20,23)/t15-/m0/s1 |
| InChIKey | MYEDKQAUNUEMOD-HNNXBMFYSA-N |
| XLogP | 3.23 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|