C17H19FN4O2 — CID 100741145
[(3S)-1-(2-aminopyrimidin-4-yl)piperidin-3-yl] 5-fluoro-2-methylbenzoate (PubChem CID 100741145) has the molecular formula C17H19FN4O2 and a molecular weight of 330.36 g/mol. Its IUPAC name is [(3S)-1-(2-aminopyrimidin-4-yl)piperidin-3-yl] 5-fluoro-2-methylbenzoate.
| Compound Name | [(3S)-1-(2-aminopyrimidin-4-yl)piperidin-3-yl] 5-fluoro-2-methylbenzoate |
|---|---|
| PubChem CID | 100741145 |
| Molecular Formula | C17H19FN4O2 |
| Molecular Weight | 330.36 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | [(3S)-1-(2-aminopyrimidin-4-yl)piperidin-3-yl] 5-fluoro-2-methylbenzoate |
| SMILES | Cc1ccc(F)cc1C(=O)O[C@H]1CCCN(c2ccnc(N)n2)C1 |
| InChI | InChI=1S/C17H19FN4O2/c1-11-4-5-12(18)9-14(11)16(23)24-13-3-2-8-22(10-13)15-6-7-20-17(19)21-15/h4-7,9,13H,2-3,8,10H2,1H3,(H2,19,20,21)/t13-/m0/s1 |
| InChIKey | UFJGKNVYONTFMT-ZDUSSCGKSA-N |
| XLogP | 2.33 |
| TPSA | 81.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.36 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |