C18H16N4O2 — CID 90353046
ethyl 3-[(2-pyridin-4-ylpyrimidin-4-yl)amino]benzoate (PubChem CID 90353046) has the molecular formula C18H16N4O2 and a molecular weight of 320.35 g/mol. Its IUPAC name is ethyl 3-[(2-pyridin-4-ylpyrimidin-4-yl)amino]benzoate.
| Compound Name | ethyl 3-[(2-pyridin-4-ylpyrimidin-4-yl)amino]benzoate |
|---|---|
| PubChem CID | 90353046 |
| Molecular Formula | C18H16N4O2 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | ethyl 3-[(2-pyridin-4-ylpyrimidin-4-yl)amino]benzoate |
| SMILES | CCOC(=O)c1cccc(Nc2ccnc(-c3ccncc3)n2)c1 |
| InChI | InChI=1S/C18H16N4O2/c1-2-24-18(23)14-4-3-5-15(12-14)21-16-8-11-20-17(22-16)13-6-9-19-10-7-13/h3-12H,2H2,1H3,(H,20,21,22) |
| InChIKey | LEBPQOLKHNPEGD-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |