C18H16N4O3 — CID 69235737
ethyl 3-[[4-(1-oxidopyridin-1-ium-4-yl)pyrimidin-2-yl]amino]benzoate (PubChem CID 69235737) has the molecular formula C18H16N4O3 and a molecular weight of 336.35 g/mol. Its IUPAC name is ethyl 3-[[4-(1-oxidopyridin-1-ium-4-yl)pyrimidin-2-yl]amino]benzoate.
| Compound Name | ethyl 3-[[4-(1-oxidopyridin-1-ium-4-yl)pyrimidin-2-yl]amino]benzoate |
|---|---|
| PubChem CID | 69235737 |
| Molecular Formula | C18H16N4O3 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | ethyl 3-[[4-(1-oxidopyridin-1-ium-4-yl)pyrimidin-2-yl]amino]benzoate |
| SMILES | CCOC(=O)c1cccc(Nc2nccc(-c3cc[n+]([O-])cc3)n2)c1 |
| InChI | InChI=1S/C18H16N4O3/c1-2-25-17(23)14-4-3-5-15(12-14)20-18-19-9-6-16(21-18)13-7-10-22(24)11-8-13/h3-12H,2H2,1H3,(H,19,20,21) |
| InChIKey | IACMEUGYJSKUKR-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 91.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|