C15H28N2O4S — CID 100741820
1-[[4-(2-hydroxyethoxy)oxan-4-yl]methyl]-3-[[(2S)-2-methylthiolan-2-yl]methyl]urea (PubChem CID 100741820) has the molecular formula C15H28N2O4S and a molecular weight of 332.47 g/mol. Its IUPAC name is 1-[[4-(2-hydroxyethoxy)oxan-4-yl]methyl]-3-[[(2S)-2-methylthiolan-2-yl]methyl]urea.
| Compound Name | 1-[[4-(2-hydroxyethoxy)oxan-4-yl]methyl]-3-[[(2S)-2-methylthiolan-2-yl]methyl]urea |
|---|---|
| PubChem CID | 100741820 |
| Molecular Formula | C15H28N2O4S |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | 1-[[4-(2-hydroxyethoxy)oxan-4-yl]methyl]-3-[[(2S)-2-methylthiolan-2-yl]methyl]urea |
| SMILES | C[C@@]1(CNC(=O)NCC2(OCCO)CCOCC2)CCCS1 |
| InChI | InChI=1S/C15H28N2O4S/c1-14(3-2-10-22-14)11-16-13(19)17-12-15(21-9-6-18)4-7-20-8-5-15/h18H,2-12H2,1H3,(H2,16,17,19)/t14-/m0/s1 |
| InChIKey | CZUBODPVUSKTQX-AWEZNQCLSA-N |
| XLogP | 1.13 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |