C31H30N4O2 — CID 10074319
N-[3-[4-(adamantane-2-carbonylamino)phenyl]-1H-indol-5-yl]pyridine-2-carboxamide (PubChem CID 10074319) has the molecular formula C31H30N4O2 and a molecular weight of 490.61 g/mol. Its IUPAC name is N-[3-[4-(adamantane-2-carbonylamino)phenyl]-1H-indol-5-yl]pyridine-2-carboxamide.
| Compound Name | N-[3-[4-(adamantane-2-carbonylamino)phenyl]-1H-indol-5-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 10074319 |
| Molecular Formula | C31H30N4O2 |
| Molecular Weight | 490.61 g/mol |
| Exact Mass | 490.24 |
| IUPAC Name | N-[3-[4-(adamantane-2-carbonylamino)phenyl]-1H-indol-5-yl]pyridine-2-carboxamide |
| SMILES | O=C(Nc1ccc2[nH]cc(-c3ccc(NC(=O)C4C5CC6CC(C5)CC4C6)cc3)c2c1)c1ccccn1 |
| InChI | InChI=1S/C31H30N4O2/c36-30(28-3-1-2-10-32-28)35-24-8-9-27-25(16-24)26(17-33-27)20-4-6-23(7-5-20)34-31(37)29-21-12-18-11-19(14-21)15-22(29)13-18/h1-10,16-19,21-22,29,33H,11-15H2,(H,34,37)(H,35,36) |
| InChIKey | VQYBUNJELSXHIV-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.61 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |