C19H25N3O2 — CID 100745064
1-[2-(4-ethylpiperazin-1-yl)-2-oxoethyl]-5,7-dimethylquinolin-4-one (PubChem CID 100745064) has the molecular formula C19H25N3O2 and a molecular weight of 327.43 g/mol. Its IUPAC name is 1-[2-(4-ethylpiperazin-1-yl)-2-oxoethyl]-5,7-dimethylquinolin-4-one.
| Compound Name | 1-[2-(4-ethylpiperazin-1-yl)-2-oxoethyl]-5,7-dimethylquinolin-4-one |
|---|---|
| PubChem CID | 100745064 |
| Molecular Formula | C19H25N3O2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | 1-[2-(4-ethylpiperazin-1-yl)-2-oxoethyl]-5,7-dimethylquinolin-4-one |
| SMILES | CCN1CCN(C(=O)Cn2ccc(=O)c3c(C)cc(C)cc32)CC1 |
| InChI | InChI=1S/C19H25N3O2/c1-4-20-7-9-21(10-8-20)18(24)13-22-6-5-17(23)19-15(3)11-14(2)12-16(19)22/h5-6,11-12H,4,7-10,13H2,1-3H3 |
| InChIKey | ZNMOFPCYZQHOHW-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |