C17H22N2O2 — CID 100744049
N-tert-butyl-2-(5,7-dimethyl-4-oxoquinolin-1-yl)acetamide (PubChem CID 100744049) has the molecular formula C17H22N2O2 and a molecular weight of 286.38 g/mol. Its IUPAC name is N-tert-butyl-2-(5,7-dimethyl-4-oxoquinolin-1-yl)acetamide.
| Compound Name | N-tert-butyl-2-(5,7-dimethyl-4-oxoquinolin-1-yl)acetamide |
|---|---|
| PubChem CID | 100744049 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | N-tert-butyl-2-(5,7-dimethyl-4-oxoquinolin-1-yl)acetamide |
| SMILES | Cc1cc(C)c2c(=O)ccn(CC(=O)NC(C)(C)C)c2c1 |
| InChI | InChI=1S/C17H22N2O2/c1-11-8-12(2)16-13(9-11)19(7-6-14(16)20)10-15(21)18-17(3,4)5/h6-9H,10H2,1-5H3,(H,18,21) |
| InChIKey | UVZHKCOPOGRUES-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |