C19H26N2O3 — CID 100745016
2-(5,7-dimethyl-4-oxoquinolin-1-yl)-N-(3-propan-2-yloxypropyl)acetamide (PubChem CID 100745016) has the molecular formula C19H26N2O3 and a molecular weight of 330.43 g/mol. Its IUPAC name is 2-(5,7-dimethyl-4-oxoquinolin-1-yl)-N-(3-propan-2-yloxypropyl)acetamide.
| Compound Name | 2-(5,7-dimethyl-4-oxoquinolin-1-yl)-N-(3-propan-2-yloxypropyl)acetamide |
|---|---|
| PubChem CID | 100745016 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | 2-(5,7-dimethyl-4-oxoquinolin-1-yl)-N-(3-propan-2-yloxypropyl)acetamide |
| SMILES | Cc1cc(C)c2c(=O)ccn(CC(=O)NCCCOC(C)C)c2c1 |
| InChI | InChI=1S/C19H26N2O3/c1-13(2)24-9-5-7-20-18(23)12-21-8-6-17(22)19-15(4)10-14(3)11-16(19)21/h6,8,10-11,13H,5,7,9,12H2,1-4H3,(H,20,23) |
| InChIKey | PZVLSRXHBNWWOG-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|