C23H26N2O2 — CID 100745155
2-(5,7-dimethyl-4-oxoquinolin-1-yl)-N-[(2R)-4-phenylbutan-2-yl]acetamide (PubChem CID 100745155) has the molecular formula C23H26N2O2 and a molecular weight of 362.47 g/mol. Its IUPAC name is 2-(5,7-dimethyl-4-oxoquinolin-1-yl)-N-[(2R)-4-phenylbutan-2-yl]acetamide.
| Compound Name | 2-(5,7-dimethyl-4-oxoquinolin-1-yl)-N-[(2R)-4-phenylbutan-2-yl]acetamide |
|---|---|
| PubChem CID | 100745155 |
| Molecular Formula | C23H26N2O2 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | 2-(5,7-dimethyl-4-oxoquinolin-1-yl)-N-[(2R)-4-phenylbutan-2-yl]acetamide |
| SMILES | Cc1cc(C)c2c(=O)ccn(CC(=O)N[C@H](C)CCc3ccccc3)c2c1 |
| InChI | InChI=1S/C23H26N2O2/c1-16-13-17(2)23-20(14-16)25(12-11-21(23)26)15-22(27)24-18(3)9-10-19-7-5-4-6-8-19/h4-8,11-14,18H,9-10,15H2,1-3H3,(H,24,27)/t18-/m1/s1 |
| InChIKey | OJEOCIHLMMFGPX-GOSISDBHSA-N |
| XLogP | 3.76 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |