C22H34N2O3 — CID 100754614
N-[2-cyano-4-(2-methylpropoxy)phenyl]-2-methoxy-4-methyl-2-(2-methylpropyl)pentanamide (PubChem CID 100754614) has the molecular formula C22H34N2O3 and a molecular weight of 374.53 g/mol. Its IUPAC name is N-[2-cyano-4-(2-methylpropoxy)phenyl]-2-methoxy-4-methyl-2-(2-methylpropyl)pentanamide.
| Compound Name | N-[2-cyano-4-(2-methylpropoxy)phenyl]-2-methoxy-4-methyl-2-(2-methylpropyl)pentanamide |
|---|---|
| PubChem CID | 100754614 |
| Molecular Formula | C22H34N2O3 |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.26 |
| IUPAC Name | N-[2-cyano-4-(2-methylpropoxy)phenyl]-2-methoxy-4-methyl-2-(2-methylpropyl)pentanamide |
| SMILES | COC(CC(C)C)(CC(C)C)C(=O)Nc1ccc(OCC(C)C)cc1C#N |
| InChI | InChI=1S/C22H34N2O3/c1-15(2)11-22(26-7,12-16(3)4)21(25)24-20-9-8-19(10-18(20)13-23)27-14-17(5)6/h8-10,15-17H,11-12,14H2,1-7H3,(H,24,25) |
| InChIKey | FJKHCDXWYISRSV-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |