C26H24Cl2N4O4 — CID 10075593
dimethyl 2-[2-(2-amino-4,5-dichlorophenyl)-1-[4-(2-methylimidazo[4,5-c]pyridin-1-yl)phenyl]ethyl]propanedioate (PubChem CID 10075593) has the molecular formula C26H24Cl2N4O4 and a molecular weight of 527.41 g/mol. Its IUPAC name is dimethyl 2-[2-(2-amino-4,5-dichlorophenyl)-1-[4-(2-methylimidazo[4,5-c]pyridin-1-yl)phenyl]ethyl]propanedioate.
| Compound Name | dimethyl 2-[2-(2-amino-4,5-dichlorophenyl)-1-[4-(2-methylimidazo[4,5-c]pyridin-1-yl)phenyl]ethyl]propanedioate |
|---|---|
| PubChem CID | 10075593 |
| Molecular Formula | C26H24Cl2N4O4 |
| Molecular Weight | 527.41 g/mol |
| Exact Mass | 526.12 |
| IUPAC Name | dimethyl 2-[2-(2-amino-4,5-dichlorophenyl)-1-[4-(2-methylimidazo[4,5-c]pyridin-1-yl)phenyl]ethyl]propanedioate |
| SMILES | COC(=O)C(C(=O)OC)C(Cc1cc(Cl)c(Cl)cc1N)c1ccc(-n2c(C)nc3cnccc32)cc1 |
| InChI | InChI=1S/C26H24Cl2N4O4/c1-14-31-22-13-30-9-8-23(22)32(14)17-6-4-15(5-7-17)18(24(25(33)35-2)26(34)36-3)10-16-11-19(27)20(28)12-21(16)29/h4-9,11-13,18,24H,10,29H2,1-3H3 |
| InChIKey | IOWFCUCHPPJZBN-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 109.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.41 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|