C22H17Cl2N5O2 — CID 54443356
2-amino-3,5-dichloro-N-[2-[4-(2-methylimidazo[4,5-c]pyridin-1-yl)phenyl]-2-oxoethyl]benzamide (PubChem CID 54443356) has the molecular formula C22H17Cl2N5O2 and a molecular weight of 454.32 g/mol. Its IUPAC name is 2-amino-3,5-dichloro-N-[2-[4-(2-methylimidazo[4,5-c]pyridin-1-yl)phenyl]-2-oxoethyl]benzamide.
| Compound Name | 2-amino-3,5-dichloro-N-[2-[4-(2-methylimidazo[4,5-c]pyridin-1-yl)phenyl]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 54443356 |
| Molecular Formula | C22H17Cl2N5O2 |
| Molecular Weight | 454.32 g/mol |
| Exact Mass | 453.08 |
| IUPAC Name | 2-amino-3,5-dichloro-N-[2-[4-(2-methylimidazo[4,5-c]pyridin-1-yl)phenyl]-2-oxoethyl]benzamide |
| SMILES | Cc1nc2cnccc2n1-c1ccc(C(=O)CNC(=O)c2cc(Cl)cc(Cl)c2N)cc1 |
| InChI | InChI=1S/C22H17Cl2N5O2/c1-12-28-18-10-26-7-6-19(18)29(12)15-4-2-13(3-5-15)20(30)11-27-22(31)16-8-14(23)9-17(24)21(16)25/h2-10H,11,25H2,1H3,(H,27,31) |
| InChIKey | WPSBHYGEACUWHU-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.32 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|