C24H18Cl2N4O6 — CID 67946272
2-(4,5-dichloro-2-nitrophenyl)-2-[1-[4-(2-methylimidazo[4,5-c]pyridin-1-yl)phenyl]ethyl]propanedioic acid (PubChem CID 67946272) has the molecular formula C24H18Cl2N4O6 and a molecular weight of 529.34 g/mol. Its IUPAC name is 2-(4,5-dichloro-2-nitrophenyl)-2-[1-[4-(2-methylimidazo[4,5-c]pyridin-1-yl)phenyl]ethyl]propanedioic acid.
| Compound Name | 2-(4,5-dichloro-2-nitrophenyl)-2-[1-[4-(2-methylimidazo[4,5-c]pyridin-1-yl)phenyl]ethyl]propanedioic acid |
|---|---|
| PubChem CID | 67946272 |
| Molecular Formula | C24H18Cl2N4O6 |
| Molecular Weight | 529.34 g/mol |
| Exact Mass | 528.06 |
| IUPAC Name | 2-(4,5-dichloro-2-nitrophenyl)-2-[1-[4-(2-methylimidazo[4,5-c]pyridin-1-yl)phenyl]ethyl]propanedioic acid |
| SMILES | Cc1nc2cnccc2n1-c1ccc(C(C)C(C(=O)O)(C(=O)O)c2cc(Cl)c(Cl)cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H18Cl2N4O6/c1-12(14-3-5-15(6-4-14)29-13(2)28-19-11-27-8-7-20(19)29)24(22(31)32,23(33)34)16-9-17(25)18(26)10-21(16)30(35)36/h3-12H,1-2H3,(H,31,32)(H,33,34) |
| InChIKey | TUWMDOJJSRBJJL-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 148.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.34 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|