C35H59FOSi — CID 10076031
[(7Z,11Z,15E)-12-fluoro-5,5,8,11,16-pentamethyl-18-[(1R,2S,4S)-1,3,3-trimethyl-7-oxabicyclo[2.2.1]heptan-2-yl]octadeca-7,11,15-trien-2-ynyl]-trimethylsilane (PubChem CID 10076031) has the molecular formula C35H59FOSi and a molecular weight of 542.94 g/mol. Its IUPAC name is [(7Z,11Z,15E)-12-fluoro-5,5,8,11,16-pentamethyl-18-[(1R,2S,4S)-1,3,3-trimethyl-7-oxabicyclo[2.2.1]heptan-2-yl]octadeca-7,11,15-trien-2-ynyl]-trimethylsilane.
| Compound Name | [(7Z,11Z,15E)-12-fluoro-5,5,8,11,16-pentamethyl-18-[(1R,2S,4S)-1,3,3-trimethyl-7-oxabicyclo[2.2.1]heptan-2-yl]octadeca-7,11,15-trien-2-ynyl]-trimethylsilane |
|---|---|
| PubChem CID | 10076031 |
| Molecular Formula | C35H59FOSi |
| Molecular Weight | 542.94 g/mol |
| Exact Mass | 542.43 |
| IUPAC Name | [(7Z,11Z,15E)-12-fluoro-5,5,8,11,16-pentamethyl-18-[(1R,2S,4S)-1,3,3-trimethyl-7-oxabicyclo[2.2.1]heptan-2-yl]octadeca-7,11,15-trien-2-ynyl]-trimethylsilane |
| SMILES | C/C(=C/CC(C)(C)CC#CC[Si](C)(C)C)CC/C(C)=C(\F)CC/C=C(\C)CC[C@H]1C(C)(C)[C@@H]2CC[C@@]1(C)O2 |
| InChI | InChI=1S/C35H59FOSi/c1-27(18-20-31-34(6,7)32-22-25-35(31,8)37-32)15-14-16-30(36)29(3)19-17-28(2)21-24-33(4,5)23-12-13-26-38(9,10)11/h15,21,31-32H,14,16-20,22-26H2,1-11H3/b27-15+,28-21-,30-29-/t31-,32-,35+/m0/s1 |
| InChIKey | SPJUPLUGLYMVLT-ODOLIYHNSA-N |
| XLogP | 11.20 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.94 |
| LogP ≤ 5 | 11.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|