C30H49FO — CID 11015745
(1R,4S)-2-[(3Z,7E,11E)-4-fluoro-3,8,12,16-tetramethylheptadeca-3,7,11,15-tetraenyl]-1,3,3-trimethyl-7-oxabicyclo[2.2.1]heptane (PubChem CID 11015745) has the molecular formula C30H49FO and a molecular weight of 444.72 g/mol. Its IUPAC name is (1R,4S)-2-[(3Z,7E,11E)-4-fluoro-3,8,12,16-tetramethylheptadeca-3,7,11,15-tetraenyl]-1,3,3-trimethyl-7-oxabicyclo[2.2.1]heptane.
| Compound Name | (1R,4S)-2-[(3Z,7E,11E)-4-fluoro-3,8,12,16-tetramethylheptadeca-3,7,11,15-tetraenyl]-1,3,3-trimethyl-7-oxabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 11015745 |
| Molecular Formula | C30H49FO |
| Molecular Weight | 444.72 g/mol |
| Exact Mass | 444.38 |
| IUPAC Name | (1R,4S)-2-[(3Z,7E,11E)-4-fluoro-3,8,12,16-tetramethylheptadeca-3,7,11,15-tetraenyl]-1,3,3-trimethyl-7-oxabicyclo[2.2.1]heptane |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C(F)=C(\C)CCC1C(C)(C)[C@@H]2CC[C@@]1(C)O2 |
| InChI | InChI=1S/C30H49FO/c1-22(2)12-9-13-23(3)14-10-15-24(4)16-11-17-26(31)25(5)18-19-27-29(6,7)28-20-21-30(27,8)32-28/h12,14,16,27-28H,9-11,13,15,17-21H2,1-8H3/b23-14+,24-16+,26-25-/t27?,28-,30+/m0/s1 |
| InChIKey | WPKUIFDNENETMR-YFTILATRSA-N |
| XLogP | 9.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.72 |
| LogP ≤ 5 | 9.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|