C20H34O — CID 162941183
2-(3,8-dimethylnona-3,7-dienyl)-1,3,3-trimethyl-7-oxabicyclo[2.2.1]heptane (PubChem CID 162941183) has the molecular formula C20H34O and a molecular weight of 290.49 g/mol. Its IUPAC name is 2-(3,8-dimethylnona-3,7-dienyl)-1,3,3-trimethyl-7-oxabicyclo[2.2.1]heptane.
| Compound Name | 2-(3,8-dimethylnona-3,7-dienyl)-1,3,3-trimethyl-7-oxabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 162941183 |
| Molecular Formula | C20H34O |
| Molecular Weight | 290.49 g/mol |
| Exact Mass | 290.26 |
| IUPAC Name | 2-(3,8-dimethylnona-3,7-dienyl)-1,3,3-trimethyl-7-oxabicyclo[2.2.1]heptane |
| SMILES | CC(C)=CCCC=C(C)CCC1C2(C)CCC(O2)C1(C)C |
| InChI | InChI=1S/C20H34O/c1-15(2)9-7-8-10-16(3)11-12-17-19(4,5)18-13-14-20(17,6)21-18/h9-10,17-18H,7-8,11-14H2,1-6H3 |
| InChIKey | AQSIUPQOWSEZOG-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.49 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|