C18H30O2 — CID 24997205
(E)-6-methyl-8-[(1R,2S,4S)-1,3,3-trimethyl-7-oxabicyclo[2.2.1]heptan-2-yl]oct-5-en-2-one (PubChem CID 24997205) has the molecular formula C18H30O2 and a molecular weight of 278.44 g/mol. Its IUPAC name is (E)-6-methyl-8-[(1R,2S,4S)-1,3,3-trimethyl-7-oxabicyclo[2.2.1]heptan-2-yl]oct-5-en-2-one.
| Compound Name | (E)-6-methyl-8-[(1R,2S,4S)-1,3,3-trimethyl-7-oxabicyclo[2.2.1]heptan-2-yl]oct-5-en-2-one |
|---|---|
| PubChem CID | 24997205 |
| Molecular Formula | C18H30O2 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | (E)-6-methyl-8-[(1R,2S,4S)-1,3,3-trimethyl-7-oxabicyclo[2.2.1]heptan-2-yl]oct-5-en-2-one |
| SMILES | CC(=O)CC/C=C(\C)CC[C@H]1C(C)(C)[C@@H]2CC[C@@]1(C)O2 |
| InChI | InChI=1S/C18H30O2/c1-13(7-6-8-14(2)19)9-10-15-17(3,4)16-11-12-18(15,5)20-16/h7,15-16H,6,8-12H2,1-5H3/b13-7+/t15-,16-,18+/m0/s1 |
| InChIKey | YREXDJKVVZTWSU-RMMJXNQTSA-N |
| XLogP | 4.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|