C25H32ClN5O7 — CID 10076231
(6R,7S)-7-[[(2R)-2-[[4-[5-aminopentyl(hydroxy)amino]-4-oxobutanoyl]amino]-2-phenylacetyl]amino]-3-chloro-8-oxo-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 10076231) has the molecular formula C25H32ClN5O7 and a molecular weight of 550.01 g/mol. Its IUPAC name is (6R,7S)-7-[[(2R)-2-[[4-[5-aminopentyl(hydroxy)amino]-4-oxobutanoyl]amino]-2-phenylacetyl]amino]-3-chloro-8-oxo-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R,7S)-7-[[(2R)-2-[[4-[5-aminopentyl(hydroxy)amino]-4-oxobutanoyl]amino]-2-phenylacetyl]amino]-3-chloro-8-oxo-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 10076231 |
| Molecular Formula | C25H32ClN5O7 |
| Molecular Weight | 550.01 g/mol |
| Exact Mass | 549.20 |
| IUPAC Name | (6R,7S)-7-[[(2R)-2-[[4-[5-aminopentyl(hydroxy)amino]-4-oxobutanoyl]amino]-2-phenylacetyl]amino]-3-chloro-8-oxo-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | NCCCCCN(O)C(=O)CCC(=O)N[C@@H](C(=O)N[C@@H]1C(=O)N2C(C(=O)O)=C(Cl)CC[C@H]12)c1ccccc1 |
| InChI | InChI=1S/C25H32ClN5O7/c26-16-9-10-17-21(24(35)31(17)22(16)25(36)37)29-23(34)20(15-7-3-1-4-8-15)28-18(32)11-12-19(33)30(38)14-6-2-5-13-27/h1,3-4,7-8,17,20-21,38H,2,5-6,9-14,27H2,(H,28,32)(H,29,34)(H,36,37)/t17-,20-,21+/m1/s1 |
| InChIKey | WPZKSIIBYWENMV-UIFIKXQLSA-N |
| XLogP | 1.00 |
| TPSA | 182.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.01 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|