C25H22ClN3O8 — CID 135520729
(6R,7S)-3-chloro-7-[[(2R)-2-[(2-ethoxycarbonyl-3-hydroxy-6-oxocyclohexa-2,4-dien-1-ylidene)amino]-2-phenylacetyl]amino]-8-oxo-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 135520729) has the molecular formula C25H22ClN3O8 and a molecular weight of 527.92 g/mol. Its IUPAC name is (6R,7S)-3-chloro-7-[[(2R)-2-[(2-ethoxycarbonyl-3-hydroxy-6-oxocyclohexa-2,4-dien-1-ylidene)amino]-2-phenylacetyl]amino]-8-oxo-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R,7S)-3-chloro-7-[[(2R)-2-[(2-ethoxycarbonyl-3-hydroxy-6-oxocyclohexa-2,4-dien-1-ylidene)amino]-2-phenylacetyl]amino]-8-oxo-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 135520729 |
| Molecular Formula | C25H22ClN3O8 |
| Molecular Weight | 527.92 g/mol |
| Exact Mass | 527.11 |
| IUPAC Name | (6R,7S)-3-chloro-7-[[(2R)-2-[(2-ethoxycarbonyl-3-hydroxy-6-oxocyclohexa-2,4-dien-1-ylidene)amino]-2-phenylacetyl]amino]-8-oxo-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CCOC(=O)C1=C(O)C=CC(=O)/C1=N\[C@@H](C(=O)N[C@@H]1C(=O)N2C(C(=O)O)=C(Cl)CC[C@H]12)c1ccccc1 |
| InChI | InChI=1S/C25H22ClN3O8/c1-2-37-25(36)17-15(30)10-11-16(31)20(17)27-18(12-6-4-3-5-7-12)22(32)28-19-14-9-8-13(26)21(24(34)35)29(14)23(19)33/h3-7,10-11,14,18-19,30H,2,8-9H2,1H3,(H,28,32)(H,34,35)/b27-20+/t14-,18-,19+/m1/s1 |
| InChIKey | LMDXQCLLEIXHOC-SGCLULTBSA-N |
| XLogP | 1.71 |
| TPSA | 162.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.92 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|