C38H40Cl2N6O5S — CID 173098174
(7R)-7-[[2-(2-amino-5-chloro-1,3-thiazol-4-yl)-2-trityloxyiminoacetyl]amino]-3-chloro-8-oxo-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;N,N-diethylethanamine (PubChem CID 173098174) has the molecular formula C38H40Cl2N6O5S and a molecular weight of 763.75 g/mol. Its IUPAC name is (7R)-7-[[2-(2-amino-5-chloro-1,3-thiazol-4-yl)-2-trityloxyiminoacetyl]amino]-3-chloro-8-oxo-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;N,N-diethylethanamine.
| Compound Name | (7R)-7-[[2-(2-amino-5-chloro-1,3-thiazol-4-yl)-2-trityloxyiminoacetyl]amino]-3-chloro-8-oxo-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;N,N-diethylethanamine |
|---|---|
| PubChem CID | 173098174 |
| Molecular Formula | C38H40Cl2N6O5S |
| Molecular Weight | 763.75 g/mol |
| Exact Mass | 762.22 |
| IUPAC Name | (7R)-7-[[2-(2-amino-5-chloro-1,3-thiazol-4-yl)-2-trityloxyiminoacetyl]amino]-3-chloro-8-oxo-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;N,N-diethylethanamine |
| SMILES | CCN(CC)CC.Nc1nc(C(=NOC(c2ccccc2)(c2ccccc2)c2ccccc2)C(=O)N[C@H]2C(=O)N3C(C(=O)O)=C(Cl)CCC23)c(Cl)s1 |
| InChI | InChI=1S/C32H25Cl2N5O5S.C6H15N/c33-21-16-17-22-23(29(41)39(22)26(21)30(42)43)36-28(40)25(24-27(34)45-31(35)37-24)38-44-32(18-10-4-1-5-11-18,19-12-6-2-7-13-19)20-14-8-3-9-15-20;1-4-7(5-2)6-3/h1-15,22-23H,16-17H2,(H2,35,37)(H,36,40)(H,42,43);4-6H2,1-3H3/t22?,23-;/m1./s1 |
| InChIKey | OIDXOBWUDWFEAR-DBCZNGTMSA-N |
| XLogP | 6.46 |
| TPSA | 150.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.75 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|