C34H31N5O4S — CID 89268712
(2Z)-2-(2-amino-5-methyl-1,3-thiazol-4-yl)-N-(2-formyl-3-methyl-8-oxo-1-azabicyclo[4.2.0]oct-2-en-7-yl)-2-trityloxyiminoacetamide (PubChem CID 89268712) has the molecular formula C34H31N5O4S and a molecular weight of 605.72 g/mol. Its IUPAC name is (2Z)-2-(2-amino-5-methyl-1,3-thiazol-4-yl)-N-(2-formyl-3-methyl-8-oxo-1-azabicyclo[4.2.0]oct-2-en-7-yl)-2-trityloxyiminoacetamide.
| Compound Name | (2Z)-2-(2-amino-5-methyl-1,3-thiazol-4-yl)-N-(2-formyl-3-methyl-8-oxo-1-azabicyclo[4.2.0]oct-2-en-7-yl)-2-trityloxyiminoacetamide |
|---|---|
| PubChem CID | 89268712 |
| Molecular Formula | C34H31N5O4S |
| Molecular Weight | 605.72 g/mol |
| Exact Mass | 605.21 |
| IUPAC Name | (2Z)-2-(2-amino-5-methyl-1,3-thiazol-4-yl)-N-(2-formyl-3-methyl-8-oxo-1-azabicyclo[4.2.0]oct-2-en-7-yl)-2-trityloxyiminoacetamide |
| SMILES | CC1=C(C=O)N2C(=O)C(NC(=O)/C(=N\OC(c3ccccc3)(c3ccccc3)c3ccccc3)c3nc(N)sc3C)C2CC1 |
| InChI | InChI=1S/C34H31N5O4S/c1-21-18-19-26-29(32(42)39(26)27(21)20-40)36-31(41)30(28-22(2)44-33(35)37-28)38-43-34(23-12-6-3-7-13-23,24-14-8-4-9-15-24)25-16-10-5-11-17-25/h3-17,20,26,29H,18-19H2,1-2H3,(H2,35,37)(H,36,41)/b38-30- |
| InChIKey | JIVQMHZCQFOFJD-ZREQDNEKSA-N |
| XLogP | 4.71 |
| TPSA | 126.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.72 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|