C51H40ClN5O5S — CID 10056462
(6R,7S)-3-chloro-8-oxo-7-[[(2Z)-2-[2-(tritylamino)-1,3-thiazol-4-yl]-2-trityloxyiminoacetyl]amino]-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 10056462) has the molecular formula C51H40ClN5O5S and a molecular weight of 870.43 g/mol. Its IUPAC name is (6R,7S)-3-chloro-8-oxo-7-[[(2Z)-2-[2-(tritylamino)-1,3-thiazol-4-yl]-2-trityloxyiminoacetyl]amino]-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R,7S)-3-chloro-8-oxo-7-[[(2Z)-2-[2-(tritylamino)-1,3-thiazol-4-yl]-2-trityloxyiminoacetyl]amino]-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 10056462 |
| Molecular Formula | C51H40ClN5O5S |
| Molecular Weight | 870.43 g/mol |
| Exact Mass | 869.24 |
| IUPAC Name | (6R,7S)-3-chloro-8-oxo-7-[[(2Z)-2-[2-(tritylamino)-1,3-thiazol-4-yl]-2-trityloxyiminoacetyl]amino]-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | O=C(O)C1=C(Cl)CC[C@@H]2[C@H](NC(=O)/C(=N\OC(c3ccccc3)(c3ccccc3)c3ccccc3)c3csc(NC(c4ccccc4)(c4ccccc4)c4ccccc4)n3)C(=O)N12 |
| InChI | InChI=1S/C51H40ClN5O5S/c52-40-31-32-42-44(47(59)57(42)45(40)48(60)61)54-46(58)43(56-62-51(37-25-13-4-14-26-37,38-27-15-5-16-28-38)39-29-17-6-18-30-39)41-33-63-49(53-41)55-50(34-19-7-1-8-20-34,35-21-9-2-10-22-35)36-23-11-3-12-24-36/h1-30,33,42,44H,31-32H2,(H,53,55)(H,54,58)(H,60,61)/b56-43-/t42-,44+/m1/s1 |
| InChIKey | AMLQBCCAXXKEND-BVRXYKFYSA-N |
| XLogP | 9.28 |
| TPSA | 133.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 870.43 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|