C52H43ClN6O6S2 — CID 86743758
2-(chloromethyl)-4-oxo-3-[[2-[2-(tritylamino)-1,3-thiazol-4-yl]-2-trityloxyiminoacetyl]amino]azetidine-1-sulfonate;pyridin-1-ium (PubChem CID 86743758) has the molecular formula C52H43ClN6O6S2 and a molecular weight of 947.54 g/mol. Its IUPAC name is 2-(chloromethyl)-4-oxo-3-[[2-[2-(tritylamino)-1,3-thiazol-4-yl]-2-trityloxyiminoacetyl]amino]azetidine-1-sulfonate;pyridin-1-ium.
| Compound Name | 2-(chloromethyl)-4-oxo-3-[[2-[2-(tritylamino)-1,3-thiazol-4-yl]-2-trityloxyiminoacetyl]amino]azetidine-1-sulfonate;pyridin-1-ium |
|---|---|
| PubChem CID | 86743758 |
| Molecular Formula | C52H43ClN6O6S2 |
| Molecular Weight | 947.54 g/mol |
| Exact Mass | 946.24 |
| IUPAC Name | 2-(chloromethyl)-4-oxo-3-[[2-[2-(tritylamino)-1,3-thiazol-4-yl]-2-trityloxyiminoacetyl]amino]azetidine-1-sulfonate;pyridin-1-ium |
| SMILES | O=C(NC1C(=O)N(S(=O)(=O)[O-])C1CCl)C(=NOC(c1ccccc1)(c1ccccc1)c1ccccc1)c1csc(NC(c2ccccc2)(c2ccccc2)c2ccccc2)n1.c1cc[nH+]cc1 |
| InChI | InChI=1S/C47H38ClN5O6S2.C5H5N/c48-31-40-42(44(55)53(40)61(56,57)58)50-43(54)41(52-59-47(36-25-13-4-14-26-36,37-27-15-5-16-28-37)38-29-17-6-18-30-38)39-32-60-45(49-39)51-46(33-19-7-1-8-20-33,34-21-9-2-10-22-34)35-23-11-3-12-24-35;1-2-4-6-5-3-1/h1-30,32,40,42H,31H2,(H,49,51)(H,50,54)(H,56,57,58);1-5H |
| InChIKey | SERWKFVFOPLNQO-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 167.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 947.54 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|