C49H43ClN6O3S — CID 88518510
(2Z)-N-[2-(chloromethyl)-4-oxoazetidin-3-yl]-2-[2-(tritylamino)ethoxyimino]-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetamide (PubChem CID 88518510) has the molecular formula C49H43ClN6O3S and a molecular weight of 831.44 g/mol. Its IUPAC name is (2Z)-N-[2-(chloromethyl)-4-oxoazetidin-3-yl]-2-[2-(tritylamino)ethoxyimino]-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetamide.
| Compound Name | (2Z)-N-[2-(chloromethyl)-4-oxoazetidin-3-yl]-2-[2-(tritylamino)ethoxyimino]-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetamide |
|---|---|
| PubChem CID | 88518510 |
| Molecular Formula | C49H43ClN6O3S |
| Molecular Weight | 831.44 g/mol |
| Exact Mass | 830.28 |
| IUPAC Name | (2Z)-N-[2-(chloromethyl)-4-oxoazetidin-3-yl]-2-[2-(tritylamino)ethoxyimino]-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetamide |
| SMILES | O=C(NC1C(=O)NC1CCl)/C(=N\OCCNC(c1ccccc1)(c1ccccc1)c1ccccc1)c1csc(NC(c2ccccc2)(c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C49H43ClN6O3S/c50-33-41-43(45(57)52-41)54-46(58)44(56-59-32-31-51-48(35-19-7-1-8-20-35,36-21-9-2-10-22-36)37-23-11-3-12-24-37)42-34-60-47(53-42)55-49(38-25-13-4-14-26-38,39-27-15-5-16-28-39)40-29-17-6-18-30-40/h1-30,34,41,43,51H,31-33H2,(H,52,57)(H,53,55)(H,54,58)/b56-44- |
| InChIKey | QSSKUIIWHLHDOY-YYJMEGNYSA-N |
| XLogP | 8.07 |
| TPSA | 116.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 831.44 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|