C27H34FN7O5 — CID 10076370
7-[3-[4-(diaminomethylideneamino)butylamino]pyrrolidin-1-yl]-1-[(2,4-dimethoxyphenyl)methyl]-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid (PubChem CID 10076370) has the molecular formula C27H34FN7O5 and a molecular weight of 555.61 g/mol. Its IUPAC name is 7-[3-[4-(diaminomethylideneamino)butylamino]pyrrolidin-1-yl]-1-[(2,4-dimethoxyphenyl)methyl]-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid.
| Compound Name | 7-[3-[4-(diaminomethylideneamino)butylamino]pyrrolidin-1-yl]-1-[(2,4-dimethoxyphenyl)methyl]-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 10076370 |
| Molecular Formula | C27H34FN7O5 |
| Molecular Weight | 555.61 g/mol |
| Exact Mass | 555.26 |
| IUPAC Name | 7-[3-[4-(diaminomethylideneamino)butylamino]pyrrolidin-1-yl]-1-[(2,4-dimethoxyphenyl)methyl]-6-fluoro-4-oxo-1,8-naphthyridine-3-carboxylic acid |
| SMILES | COc1ccc(Cn2cc(C(=O)O)c(=O)c3cc(F)c(N4CCC(NCCCCN=C(N)N)C4)nc32)c(OC)c1 |
| InChI | InChI=1S/C27H34FN7O5/c1-39-18-6-5-16(22(11-18)40-2)13-35-15-20(26(37)38)23(36)19-12-21(28)25(33-24(19)35)34-10-7-17(14-34)31-8-3-4-9-32-27(29)30/h5-6,11-12,15,17,31H,3-4,7-10,13-14H2,1-2H3,(H,37,38)(H4,29,30,32) |
| InChIKey | IVDYYIHTLQGNFD-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 170.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.61 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|