C23H24N4O5 — CID 69030578
(15S)-7-[(2,4-dimethoxyphenyl)methyl]-4-oxo-7,9,11,17-tetrazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),2,5,8-tetraene-5-carboxylic acid (PubChem CID 69030578) has the molecular formula C23H24N4O5 and a molecular weight of 436.47 g/mol. Its IUPAC name is (15S)-7-[(2,4-dimethoxyphenyl)methyl]-4-oxo-7,9,11,17-tetrazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),2,5,8-tetraene-5-carboxylic acid.
| Compound Name | (15S)-7-[(2,4-dimethoxyphenyl)methyl]-4-oxo-7,9,11,17-tetrazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),2,5,8-tetraene-5-carboxylic acid |
|---|---|
| PubChem CID | 69030578 |
| Molecular Formula | C23H24N4O5 |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | (15S)-7-[(2,4-dimethoxyphenyl)methyl]-4-oxo-7,9,11,17-tetrazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),2,5,8-tetraene-5-carboxylic acid |
| SMILES | COc1ccc(Cn2cc(C(=O)O)c(=O)c3cc4c(nc32)N2CCC[C@H]2CN4)c(OC)c1 |
| InChI | InChI=1S/C23H24N4O5/c1-31-15-6-5-13(19(8-15)32-2)11-26-12-17(23(29)30)20(28)16-9-18-22(25-21(16)26)27-7-3-4-14(27)10-24-18/h5-6,8-9,12,14,24H,3-4,7,10-11H2,1-2H3,(H,29,30)/t14-/m0/s1 |
| InChIKey | GQPQESSTIXMXEU-AWEZNQCLSA-N |
| XLogP | 2.55 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |