C27H25N3O6 — CID 11306323
6-[(2,4-dimethoxyphenyl)methyl]-4-methyl-9-oxo-2-phenyl-2,3-dihydro-[1,4]oxazino[3,2-b][1,8]naphthyridine-8-carboxylic acid (PubChem CID 11306323) has the molecular formula C27H25N3O6 and a molecular weight of 487.51 g/mol. Its IUPAC name is 6-[(2,4-dimethoxyphenyl)methyl]-4-methyl-9-oxo-2-phenyl-2,3-dihydro-[1,4]oxazino[3,2-b][1,8]naphthyridine-8-carboxylic acid.
| Compound Name | 6-[(2,4-dimethoxyphenyl)methyl]-4-methyl-9-oxo-2-phenyl-2,3-dihydro-[1,4]oxazino[3,2-b][1,8]naphthyridine-8-carboxylic acid |
|---|---|
| PubChem CID | 11306323 |
| Molecular Formula | C27H25N3O6 |
| Molecular Weight | 487.51 g/mol |
| Exact Mass | 487.17 |
| IUPAC Name | 6-[(2,4-dimethoxyphenyl)methyl]-4-methyl-9-oxo-2-phenyl-2,3-dihydro-[1,4]oxazino[3,2-b][1,8]naphthyridine-8-carboxylic acid |
| SMILES | COc1ccc(Cn2cc(C(=O)O)c(=O)c3cc4c(nc32)N(C)CC(c2ccccc2)O4)c(OC)c1 |
| InChI | InChI=1S/C27H25N3O6/c1-29-15-23(16-7-5-4-6-8-16)36-22-12-19-24(31)20(27(32)33)14-30(25(19)28-26(22)29)13-17-9-10-18(34-2)11-21(17)35-3/h4-12,14,23H,13,15H2,1-3H3,(H,32,33) |
| InChIKey | DVEGELNVGOZWLQ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 103.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.51 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |