C12H17F3N4O2S — CID 100767989
N-[2-(dimethylamino)-2-methylpropyl]-N'-[5-(trifluoromethyl)-1,3-thiazol-2-yl]oxamide (PubChem CID 100767989) has the molecular formula C12H17F3N4O2S and a molecular weight of 338.36 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-methylpropyl]-N'-[5-(trifluoromethyl)-1,3-thiazol-2-yl]oxamide.
| Compound Name | N-[2-(dimethylamino)-2-methylpropyl]-N'-[5-(trifluoromethyl)-1,3-thiazol-2-yl]oxamide |
|---|---|
| PubChem CID | 100767989 |
| Molecular Formula | C12H17F3N4O2S |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | N-[2-(dimethylamino)-2-methylpropyl]-N'-[5-(trifluoromethyl)-1,3-thiazol-2-yl]oxamide |
| SMILES | CN(C)C(C)(C)CNC(=O)C(=O)Nc1ncc(C(F)(F)F)s1 |
| InChI | InChI=1S/C12H17F3N4O2S/c1-11(2,19(3)4)6-17-8(20)9(21)18-10-16-5-7(22-10)12(13,14)15/h5H,6H2,1-4H3,(H,17,20)(H,16,18,21) |
| InChIKey | RDJKBDIYKFVDPN-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|