About [5-(2-hydroxypropan-2-yl)-1,3-thiazol-2-yl]carbamic acid
[5-(2-hydroxypropan-2-yl)-1,3-thiazol-2-yl]carbamic acid (PubChem CID 151016388) has the molecular formula C7H10N2O3S
and a molecular weight of 202.23 g/mol. Its IUPAC name is [5-(2-hydroxypropan-2-yl)-1,3-thiazol-2-yl]carbamic acid.
Molecular Properties
| Compound Name | [5-(2-hydroxypropan-2-yl)-1,3-thiazol-2-yl]carbamic acid |
| PubChem CID | 151016388 |
| Molecular Formula | C7H10N2O3S |
| Molecular Weight | 202.23 g/mol |
| Exact Mass | 202.04 |
| IUPAC Name | [5-(2-hydroxypropan-2-yl)-1,3-thiazol-2-yl]carbamic acid |
| SMILES | CC(C)(O)c1cnc(NC(=O)O)s1 |
| InChI | InChI=1S/C7H10N2O3S/c1-7(2,12)4-3-8-5(13-4)9-6(10)11/h3,12H,1-2H3,(H,8,9)(H,10,11) |
| InChIKey | LXDVDBGJFGYMKT-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.23 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [5-(2-hydroxypropan-2-yl)-1,3-thiazol-2-yl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(2-hydroxypropan-2-yl)-1,3-thiazol-2-yl]carbamic acid?
The IUPAC name of [5-(2-hydroxypropan-2-yl)-1,3-thiazol-2-yl]carbamic acid (CID 151016388) is [5-(2-hydroxypropan-2-yl)-1,3-thiazol-2-yl]carbamic acid.
What is the SMILES notation for [5-(2-hydroxypropan-2-yl)-1,3-thiazol-2-yl]carbamic acid?
The canonical SMILES for [5-(2-hydroxypropan-2-yl)-1,3-thiazol-2-yl]carbamic acid is CC(C)(O)c1cnc(NC(=O)O)s1.
What is the InChIKey of [5-(2-hydroxypropan-2-yl)-1,3-thiazol-2-yl]carbamic acid?
The InChIKey is LXDVDBGJFGYMKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O3S/c1-7(2,12)4-3-8-5(13-4)9-6(10)11/h3,12H,1-2H3,(H,8,9)(H,10,11).
What are the key properties of [5-(2-hydroxypropan-2-yl)-1,3-thiazol-2-yl]carbamic acid?
[5-(2-hydroxypropan-2-yl)-1,3-thiazol-2-yl]carbamic acid has a molecular weight of 202.23 g/mol, XLogP of 1.46, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(2-hydroxypropan-2-yl)-1,3-thiazol-2-yl]carbamic acid is sourced from PubChem (CID 151016388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).