C16H22N6 — CID 100770819
4-amino-1-[(1-methylimidazol-2-yl)methyl]-5-(4-methylpiperidin-1-yl)pyrrole-2-carbonitrile (PubChem CID 100770819) has the molecular formula C16H22N6 and a molecular weight of 298.39 g/mol. Its IUPAC name is 4-amino-1-[(1-methylimidazol-2-yl)methyl]-5-(4-methylpiperidin-1-yl)pyrrole-2-carbonitrile.
| Compound Name | 4-amino-1-[(1-methylimidazol-2-yl)methyl]-5-(4-methylpiperidin-1-yl)pyrrole-2-carbonitrile |
|---|---|
| PubChem CID | 100770819 |
| Molecular Formula | C16H22N6 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | 4-amino-1-[(1-methylimidazol-2-yl)methyl]-5-(4-methylpiperidin-1-yl)pyrrole-2-carbonitrile |
| SMILES | CC1CCN(c2c(N)cc(C#N)n2Cc2nccn2C)CC1 |
| InChI | InChI=1S/C16H22N6/c1-12-3-6-21(7-4-12)16-14(18)9-13(10-17)22(16)11-15-19-5-8-20(15)2/h5,8-9,12H,3-4,6-7,11,18H2,1-2H3 |
| InChIKey | SIIPMYDYESNSLG-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 75.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |