C14H22N4 — CID 125062370
4-amino-5-[(3S)-3-methylpiperidin-1-yl]-1-propylpyrrole-2-carbonitrile (PubChem CID 125062370) has the molecular formula C14H22N4 and a molecular weight of 246.36 g/mol. Its IUPAC name is 4-amino-5-[(3S)-3-methylpiperidin-1-yl]-1-propylpyrrole-2-carbonitrile.
| Compound Name | 4-amino-5-[(3S)-3-methylpiperidin-1-yl]-1-propylpyrrole-2-carbonitrile |
|---|---|
| PubChem CID | 125062370 |
| Molecular Formula | C14H22N4 |
| Molecular Weight | 246.36 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | 4-amino-5-[(3S)-3-methylpiperidin-1-yl]-1-propylpyrrole-2-carbonitrile |
| SMILES | CCCn1c(C#N)cc(N)c1N1CCC[C@H](C)C1 |
| InChI | InChI=1S/C14H22N4/c1-3-6-18-12(9-15)8-13(16)14(18)17-7-4-5-11(2)10-17/h8,11H,3-7,10,16H2,1-2H3/t11-/m0/s1 |
| InChIKey | DLKYPWLTVNOFGS-NSHDSACASA-N |
| XLogP | 2.59 |
| TPSA | 57.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.36 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |