C22H24N4 — CID 100770745
4-amino-5-[(3S)-3-methylpiperidin-1-yl]-1-(naphthalen-1-ylmethyl)pyrrole-2-carbonitrile (PubChem CID 100770745) has the molecular formula C22H24N4 and a molecular weight of 344.46 g/mol. Its IUPAC name is 4-amino-5-[(3S)-3-methylpiperidin-1-yl]-1-(naphthalen-1-ylmethyl)pyrrole-2-carbonitrile.
| Compound Name | 4-amino-5-[(3S)-3-methylpiperidin-1-yl]-1-(naphthalen-1-ylmethyl)pyrrole-2-carbonitrile |
|---|---|
| PubChem CID | 100770745 |
| Molecular Formula | C22H24N4 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | 4-amino-5-[(3S)-3-methylpiperidin-1-yl]-1-(naphthalen-1-ylmethyl)pyrrole-2-carbonitrile |
| SMILES | C[C@H]1CCCN(c2c(N)cc(C#N)n2Cc2cccc3ccccc23)C1 |
| InChI | InChI=1S/C22H24N4/c1-16-6-5-11-25(14-16)22-21(24)12-19(13-23)26(22)15-18-9-4-8-17-7-2-3-10-20(17)18/h2-4,7-10,12,16H,5-6,11,14-15,24H2,1H3/t16-/m0/s1 |
| InChIKey | RJZSWFWCQZSPLX-INIZCTEOSA-N |
| XLogP | 4.38 |
| TPSA | 57.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |