C24H27N5 — CID 100772006
4-amino-5-(4-benzylpiperazin-1-yl)-1-[(3-methylphenyl)methyl]pyrrole-2-carbonitrile (PubChem CID 100772006) has the molecular formula C24H27N5 and a molecular weight of 385.52 g/mol. Its IUPAC name is 4-amino-5-(4-benzylpiperazin-1-yl)-1-[(3-methylphenyl)methyl]pyrrole-2-carbonitrile.
| Compound Name | 4-amino-5-(4-benzylpiperazin-1-yl)-1-[(3-methylphenyl)methyl]pyrrole-2-carbonitrile |
|---|---|
| PubChem CID | 100772006 |
| Molecular Formula | C24H27N5 |
| Molecular Weight | 385.52 g/mol |
| Exact Mass | 385.23 |
| IUPAC Name | 4-amino-5-(4-benzylpiperazin-1-yl)-1-[(3-methylphenyl)methyl]pyrrole-2-carbonitrile |
| SMILES | Cc1cccc(Cn2c(C#N)cc(N)c2N2CCN(Cc3ccccc3)CC2)c1 |
| InChI | InChI=1S/C24H27N5/c1-19-6-5-9-21(14-19)18-29-22(16-25)15-23(26)24(29)28-12-10-27(11-13-28)17-20-7-3-2-4-8-20/h2-9,14-15H,10-13,17-18,26H2,1H3 |
| InChIKey | CYXLBDJHZVCZQY-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 61.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.52 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |