C21H27N5 — CID 100771974
4-amino-5-(4-benzylpiperazin-1-yl)-1-cyclopentylpyrrole-2-carbonitrile (PubChem CID 100771974) has the molecular formula C21H27N5 and a molecular weight of 349.48 g/mol. Its IUPAC name is 4-amino-5-(4-benzylpiperazin-1-yl)-1-cyclopentylpyrrole-2-carbonitrile.
| Compound Name | 4-amino-5-(4-benzylpiperazin-1-yl)-1-cyclopentylpyrrole-2-carbonitrile |
|---|---|
| PubChem CID | 100771974 |
| Molecular Formula | C21H27N5 |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.23 |
| IUPAC Name | 4-amino-5-(4-benzylpiperazin-1-yl)-1-cyclopentylpyrrole-2-carbonitrile |
| SMILES | N#Cc1cc(N)c(N2CCN(Cc3ccccc3)CC2)n1C1CCCC1 |
| InChI | InChI=1S/C21H27N5/c22-15-19-14-20(23)21(26(19)18-8-4-5-9-18)25-12-10-24(11-13-25)16-17-6-2-1-3-7-17/h1-3,6-7,14,18H,4-5,8-13,16,23H2 |
| InChIKey | NVVOSANUAWAWOO-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 61.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |