C24H25N5O2 — CID 100771891
4-amino-5-[4-(1,3-benzodioxol-5-yl)piperazin-1-yl]-1-[(4-methylphenyl)methyl]pyrrole-2-carbonitrile (PubChem CID 100771891) has the molecular formula C24H25N5O2 and a molecular weight of 415.50 g/mol. Its IUPAC name is 4-amino-5-[4-(1,3-benzodioxol-5-yl)piperazin-1-yl]-1-[(4-methylphenyl)methyl]pyrrole-2-carbonitrile.
| Compound Name | 4-amino-5-[4-(1,3-benzodioxol-5-yl)piperazin-1-yl]-1-[(4-methylphenyl)methyl]pyrrole-2-carbonitrile |
|---|---|
| PubChem CID | 100771891 |
| Molecular Formula | C24H25N5O2 |
| Molecular Weight | 415.50 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | 4-amino-5-[4-(1,3-benzodioxol-5-yl)piperazin-1-yl]-1-[(4-methylphenyl)methyl]pyrrole-2-carbonitrile |
| SMILES | Cc1ccc(Cn2c(C#N)cc(N)c2N2CCN(c3ccc4c(c3)OCO4)CC2)cc1 |
| InChI | InChI=1S/C24H25N5O2/c1-17-2-4-18(5-3-17)15-29-20(14-25)12-21(26)24(29)28-10-8-27(9-11-28)19-6-7-22-23(13-19)31-16-30-22/h2-7,12-13H,8-11,15-16,26H2,1H3 |
| InChIKey | BUEXSRZLNLDHND-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 79.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.50 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|