C17H19N3O3 — CID 100774825
4-amino-5-(1,3-benzodioxol-5-yloxy)-1-pentylpyrrole-2-carbonitrile (PubChem CID 100774825) has the molecular formula C17H19N3O3 and a molecular weight of 313.36 g/mol. Its IUPAC name is 4-amino-5-(1,3-benzodioxol-5-yloxy)-1-pentylpyrrole-2-carbonitrile.
| Compound Name | 4-amino-5-(1,3-benzodioxol-5-yloxy)-1-pentylpyrrole-2-carbonitrile |
|---|---|
| PubChem CID | 100774825 |
| Molecular Formula | C17H19N3O3 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | 4-amino-5-(1,3-benzodioxol-5-yloxy)-1-pentylpyrrole-2-carbonitrile |
| SMILES | CCCCCn1c(C#N)cc(N)c1Oc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H19N3O3/c1-2-3-4-7-20-12(10-18)8-14(19)17(20)23-13-5-6-15-16(9-13)22-11-21-15/h5-6,8-9H,2-4,7,11,19H2,1H3 |
| InChIKey | VYGLLMQCDPEJTP-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|