C16H26N2O3 — CID 100777585
(2S)-N-(6-ethoxy-2-methyl-3-pyridinyl)-2-methyl-2-propoxybutanamide (PubChem CID 100777585) has the molecular formula C16H26N2O3 and a molecular weight of 294.40 g/mol. Its IUPAC name is (2S)-N-(6-ethoxy-2-methyl-3-pyridinyl)-2-methyl-2-propoxybutanamide.
| Compound Name | (2S)-N-(6-ethoxy-2-methyl-3-pyridinyl)-2-methyl-2-propoxybutanamide |
|---|---|
| PubChem CID | 100777585 |
| Molecular Formula | C16H26N2O3 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | (2S)-N-(6-ethoxy-2-methyl-3-pyridinyl)-2-methyl-2-propoxybutanamide |
| SMILES | CCCO[C@@](C)(CC)C(=O)Nc1ccc(OCC)nc1C |
| InChI | InChI=1S/C16H26N2O3/c1-6-11-21-16(5,7-2)15(19)18-13-9-10-14(20-8-3)17-12(13)4/h9-10H,6-8,11H2,1-5H3,(H,18,19)/t16-/m0/s1 |
| InChIKey | LLGZEAIBYSZMBM-INIZCTEOSA-N |
| XLogP | 3.32 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |