C21H36N2O3 — CID 100776545
2-ethoxy-4-methyl-N-(2-methyl-6-propoxy-3-pyridinyl)-2-(2-methylpropyl)pentanamide (PubChem CID 100776545) has the molecular formula C21H36N2O3 and a molecular weight of 364.53 g/mol. Its IUPAC name is 2-ethoxy-4-methyl-N-(2-methyl-6-propoxy-3-pyridinyl)-2-(2-methylpropyl)pentanamide.
| Compound Name | 2-ethoxy-4-methyl-N-(2-methyl-6-propoxy-3-pyridinyl)-2-(2-methylpropyl)pentanamide |
|---|---|
| PubChem CID | 100776545 |
| Molecular Formula | C21H36N2O3 |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.27 |
| IUPAC Name | 2-ethoxy-4-methyl-N-(2-methyl-6-propoxy-3-pyridinyl)-2-(2-methylpropyl)pentanamide |
| SMILES | CCCOc1ccc(NC(=O)C(CC(C)C)(CC(C)C)OCC)c(C)n1 |
| InChI | InChI=1S/C21H36N2O3/c1-8-12-25-19-11-10-18(17(7)22-19)23-20(24)21(26-9-2,13-15(3)4)14-16(5)6/h10-11,15-16H,8-9,12-14H2,1-7H3,(H,23,24) |
| InChIKey | BDKMBSJQYVIZBN-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |