C19H32N2O4 — CID 133205697
2-ethoxy-N-[6-(2-ethoxyethoxy)-2-methyl-3-pyridinyl]-2,4-dimethylpentanamide (PubChem CID 133205697) has the molecular formula C19H32N2O4 and a molecular weight of 352.48 g/mol. Its IUPAC name is 2-ethoxy-N-[6-(2-ethoxyethoxy)-2-methyl-3-pyridinyl]-2,4-dimethylpentanamide.
| Compound Name | 2-ethoxy-N-[6-(2-ethoxyethoxy)-2-methyl-3-pyridinyl]-2,4-dimethylpentanamide |
|---|---|
| PubChem CID | 133205697 |
| Molecular Formula | C19H32N2O4 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | 2-ethoxy-N-[6-(2-ethoxyethoxy)-2-methyl-3-pyridinyl]-2,4-dimethylpentanamide |
| SMILES | CCOCCOc1ccc(NC(=O)C(C)(CC(C)C)OCC)c(C)n1 |
| InChI | InChI=1S/C19H32N2O4/c1-7-23-11-12-24-17-10-9-16(15(5)20-17)21-18(22)19(6,25-8-2)13-14(3)4/h9-10,14H,7-8,11-13H2,1-6H3,(H,21,22) |
| InChIKey | XXDGBMFNMZLBNO-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|