C18H30N2O4 — CID 133205516
N-[6-(2-ethoxyethoxy)-2-methyl-3-pyridinyl]-2-methoxy-2,4-dimethylpentanamide (PubChem CID 133205516) has the molecular formula C18H30N2O4 and a molecular weight of 338.45 g/mol. Its IUPAC name is N-[6-(2-ethoxyethoxy)-2-methyl-3-pyridinyl]-2-methoxy-2,4-dimethylpentanamide.
| Compound Name | N-[6-(2-ethoxyethoxy)-2-methyl-3-pyridinyl]-2-methoxy-2,4-dimethylpentanamide |
|---|---|
| PubChem CID | 133205516 |
| Molecular Formula | C18H30N2O4 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | N-[6-(2-ethoxyethoxy)-2-methyl-3-pyridinyl]-2-methoxy-2,4-dimethylpentanamide |
| SMILES | CCOCCOc1ccc(NC(=O)C(C)(CC(C)C)OC)c(C)n1 |
| InChI | InChI=1S/C18H30N2O4/c1-7-23-10-11-24-16-9-8-15(14(4)19-16)20-17(21)18(5,22-6)12-13(2)3/h8-9,13H,7,10-12H2,1-6H3,(H,20,21) |
| InChIKey | IEZKFTIIDZISOH-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|