C16H26N2O4 — CID 133205585
2-methoxy-N-[6-(2-methoxyethoxy)-2-methyl-3-pyridinyl]-2-methylpentanamide (PubChem CID 133205585) has the molecular formula C16H26N2O4 and a molecular weight of 310.39 g/mol. Its IUPAC name is 2-methoxy-N-[6-(2-methoxyethoxy)-2-methyl-3-pyridinyl]-2-methylpentanamide.
| Compound Name | 2-methoxy-N-[6-(2-methoxyethoxy)-2-methyl-3-pyridinyl]-2-methylpentanamide |
|---|---|
| PubChem CID | 133205585 |
| Molecular Formula | C16H26N2O4 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | 2-methoxy-N-[6-(2-methoxyethoxy)-2-methyl-3-pyridinyl]-2-methylpentanamide |
| SMILES | CCCC(C)(OC)C(=O)Nc1ccc(OCCOC)nc1C |
| InChI | InChI=1S/C16H26N2O4/c1-6-9-16(3,21-5)15(19)18-13-7-8-14(17-12(13)2)22-11-10-20-4/h7-8H,6,9-11H2,1-5H3,(H,18,19) |
| InChIKey | NIIKOCXIDWURDP-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|