C38H31N5O5 — CID 10077842
2-[3-[(3-benzoylphenyl)carbamoylamino]-2,4-dioxo-5-phenyl-1,5-benzodiazepin-1-yl]-N-methyl-N-phenylacetamide (PubChem CID 10077842) has the molecular formula C38H31N5O5 and a molecular weight of 637.70 g/mol. Its IUPAC name is 2-[3-[(3-benzoylphenyl)carbamoylamino]-2,4-dioxo-5-phenyl-1,5-benzodiazepin-1-yl]-N-methyl-N-phenylacetamide.
| Compound Name | 2-[3-[(3-benzoylphenyl)carbamoylamino]-2,4-dioxo-5-phenyl-1,5-benzodiazepin-1-yl]-N-methyl-N-phenylacetamide |
|---|---|
| PubChem CID | 10077842 |
| Molecular Formula | C38H31N5O5 |
| Molecular Weight | 637.70 g/mol |
| Exact Mass | 637.23 |
| IUPAC Name | 2-[3-[(3-benzoylphenyl)carbamoylamino]-2,4-dioxo-5-phenyl-1,5-benzodiazepin-1-yl]-N-methyl-N-phenylacetamide |
| SMILES | CN(C(=O)CN1C(=O)C(NC(=O)Nc2cccc(C(=O)c3ccccc3)c2)C(=O)N(c2ccccc2)c2ccccc21)c1ccccc1 |
| InChI | InChI=1S/C38H31N5O5/c1-41(29-18-7-3-8-19-29)33(44)25-42-31-22-11-12-23-32(31)43(30-20-9-4-10-21-30)37(47)34(36(42)46)40-38(48)39-28-17-13-16-27(24-28)35(45)26-14-5-2-6-15-26/h2-24,34H,25H2,1H3,(H2,39,40,48) |
| InChIKey | FVGZXOUTDQORMB-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 119.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.70 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|