C30H26N4O3 — CID 11799257
1-[2,4-dioxo-5-phenyl-1-(2-phenylethyl)-1,5-benzodiazepin-3-yl]-3-phenylurea (PubChem CID 11799257) has the molecular formula C30H26N4O3 and a molecular weight of 490.56 g/mol. Its IUPAC name is 1-[2,4-dioxo-5-phenyl-1-(2-phenylethyl)-1,5-benzodiazepin-3-yl]-3-phenylurea.
| Compound Name | 1-[2,4-dioxo-5-phenyl-1-(2-phenylethyl)-1,5-benzodiazepin-3-yl]-3-phenylurea |
|---|---|
| PubChem CID | 11799257 |
| Molecular Formula | C30H26N4O3 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | 1-[2,4-dioxo-5-phenyl-1-(2-phenylethyl)-1,5-benzodiazepin-3-yl]-3-phenylurea |
| SMILES | O=C(Nc1ccccc1)NC1C(=O)N(CCc2ccccc2)c2ccccc2N(c2ccccc2)C1=O |
| InChI | InChI=1S/C30H26N4O3/c35-28-27(32-30(37)31-23-14-6-2-7-15-23)29(36)34(24-16-8-3-9-17-24)26-19-11-10-18-25(26)33(28)21-20-22-12-4-1-5-13-22/h1-19,27H,20-21H2,(H2,31,32,37) |
| InChIKey | BPQLPWWCJLTEFV-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|