C31H39N5O3 — CID 18472063
1-[5-(1-adamantylmethyl)-1-[2-(dimethylamino)ethyl]-2,4-dioxo-1,5-benzodiazepin-3-yl]-3-phenylurea (PubChem CID 18472063) has the molecular formula C31H39N5O3 and a molecular weight of 529.69 g/mol. Its IUPAC name is 1-[5-(1-adamantylmethyl)-1-[2-(dimethylamino)ethyl]-2,4-dioxo-1,5-benzodiazepin-3-yl]-3-phenylurea.
| Compound Name | 1-[5-(1-adamantylmethyl)-1-[2-(dimethylamino)ethyl]-2,4-dioxo-1,5-benzodiazepin-3-yl]-3-phenylurea |
|---|---|
| PubChem CID | 18472063 |
| Molecular Formula | C31H39N5O3 |
| Molecular Weight | 529.69 g/mol |
| Exact Mass | 529.31 |
| IUPAC Name | 1-[5-(1-adamantylmethyl)-1-[2-(dimethylamino)ethyl]-2,4-dioxo-1,5-benzodiazepin-3-yl]-3-phenylurea |
| SMILES | CN(C)CCN1C(=O)C(NC(=O)Nc2ccccc2)C(=O)N(CC23CC4CC(CC(C4)C2)C3)c2ccccc21 |
| InChI | InChI=1S/C31H39N5O3/c1-34(2)12-13-35-25-10-6-7-11-26(25)36(20-31-17-21-14-22(18-31)16-23(15-21)19-31)29(38)27(28(35)37)33-30(39)32-24-8-4-3-5-9-24/h3-11,21-23,27H,12-20H2,1-2H3,(H2,32,33,39) |
| InChIKey | DYEIJZFSAYIJRG-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.69 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|