C38H32F2N2O6 — CID 10078003
(Z)-4-[3-[(3-fluorophenyl)methyl]phenyl]-1-[4-[(Z)-4-[3-[(3-fluorophenyl)methyl]phenyl]-4-hydroxy-2-oxobut-3-enoyl]piperazin-1-yl]-4-hydroxybut-3-ene-1,2-dione (PubChem CID 10078003) has the molecular formula C38H32F2N2O6 and a molecular weight of 650.68 g/mol. Its IUPAC name is (Z)-4-[3-[(3-fluorophenyl)methyl]phenyl]-1-[4-[(Z)-4-[3-[(3-fluorophenyl)methyl]phenyl]-4-hydroxy-2-oxobut-3-enoyl]piperazin-1-yl]-4-hydroxybut-3-ene-1,2-dione.
| Compound Name | (Z)-4-[3-[(3-fluorophenyl)methyl]phenyl]-1-[4-[(Z)-4-[3-[(3-fluorophenyl)methyl]phenyl]-4-hydroxy-2-oxobut-3-enoyl]piperazin-1-yl]-4-hydroxybut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 10078003 |
| Molecular Formula | C38H32F2N2O6 |
| Molecular Weight | 650.68 g/mol |
| Exact Mass | 650.22 |
| IUPAC Name | (Z)-4-[3-[(3-fluorophenyl)methyl]phenyl]-1-[4-[(Z)-4-[3-[(3-fluorophenyl)methyl]phenyl]-4-hydroxy-2-oxobut-3-enoyl]piperazin-1-yl]-4-hydroxybut-3-ene-1,2-dione |
| SMILES | O=C(/C=C(\O)c1cccc(Cc2cccc(F)c2)c1)C(=O)N1CCN(C(=O)C(=O)/C=C(\O)c2cccc(Cc3cccc(F)c3)c2)CC1 |
| InChI | InChI=1S/C38H32F2N2O6/c39-31-11-3-7-27(21-31)17-25-5-1-9-29(19-25)33(43)23-35(45)37(47)41-13-15-42(16-14-41)38(48)36(46)24-34(44)30-10-2-6-26(20-30)18-28-8-4-12-32(40)22-28/h1-12,19-24,43-44H,13-18H2/b33-23-,34-24- |
| InChIKey | SPCNDPKDSTWDNB-DQWRGTGXSA-N |
| XLogP | 5.45 |
| TPSA | 115.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.68 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|