C37H32F2N2O6 — CID 20833742
(Z)-4-[3-[(2-fluorophenyl)methyl]phenyl]-N-[3-[[(E)-4-[3-[(2-fluorophenyl)methyl]phenyl]-4-hydroxy-2-oxobut-3-enoyl]amino]propyl]-4-hydroxy-2-oxobut-3-enamide (PubChem CID 20833742) has the molecular formula C37H32F2N2O6 and a molecular weight of 638.67 g/mol. Its IUPAC name is (Z)-4-[3-[(2-fluorophenyl)methyl]phenyl]-N-[3-[[(E)-4-[3-[(2-fluorophenyl)methyl]phenyl]-4-hydroxy-2-oxobut-3-enoyl]amino]propyl]-4-hydroxy-2-oxobut-3-enamide.
| Compound Name | (Z)-4-[3-[(2-fluorophenyl)methyl]phenyl]-N-[3-[[(E)-4-[3-[(2-fluorophenyl)methyl]phenyl]-4-hydroxy-2-oxobut-3-enoyl]amino]propyl]-4-hydroxy-2-oxobut-3-enamide |
|---|---|
| PubChem CID | 20833742 |
| Molecular Formula | C37H32F2N2O6 |
| Molecular Weight | 638.67 g/mol |
| Exact Mass | 638.22 |
| IUPAC Name | (Z)-4-[3-[(2-fluorophenyl)methyl]phenyl]-N-[3-[[(E)-4-[3-[(2-fluorophenyl)methyl]phenyl]-4-hydroxy-2-oxobut-3-enoyl]amino]propyl]-4-hydroxy-2-oxobut-3-enamide |
| SMILES | O=C(/C=C(\O)c1cccc(Cc2ccccc2F)c1)C(=O)NCCCNC(=O)C(=O)/C=C(/O)c1cccc(Cc2ccccc2F)c1 |
| InChI | InChI=1S/C37H32F2N2O6/c38-30-14-3-1-10-26(30)18-24-8-5-12-28(20-24)32(42)22-34(44)36(46)40-16-7-17-41-37(47)35(45)23-33(43)29-13-6-9-25(21-29)19-27-11-2-4-15-31(27)39/h1-6,8-15,20-23,42-43H,7,16-19H2,(H,40,46)(H,41,47)/b32-22-,33-23+ |
| InChIKey | QJGDYWCJUQDKJR-BDZLSRGKSA-N |
| XLogP | 5.41 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.67 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|