C41H64O5S — CID 10078171
(5S)-3-[(E,15S)-15-hydroxy-15-[(2S,5R)-5-[(1R)-1-hydroxyundecyl]oxolan-2-yl]pentadec-9-en-11-ynyl]-5-methyl-3-phenylsulfanyloxolan-2-one (PubChem CID 10078171) has the molecular formula C41H64O5S and a molecular weight of 669.03 g/mol. Its IUPAC name is (5S)-3-[(E,15S)-15-hydroxy-15-[(2S,5R)-5-[(1R)-1-hydroxyundecyl]oxolan-2-yl]pentadec-9-en-11-ynyl]-5-methyl-3-phenylsulfanyloxolan-2-one.
| Compound Name | (5S)-3-[(E,15S)-15-hydroxy-15-[(2S,5R)-5-[(1R)-1-hydroxyundecyl]oxolan-2-yl]pentadec-9-en-11-ynyl]-5-methyl-3-phenylsulfanyloxolan-2-one |
|---|---|
| PubChem CID | 10078171 |
| Molecular Formula | C41H64O5S |
| Molecular Weight | 669.03 g/mol |
| Exact Mass | 668.45 |
| IUPAC Name | (5S)-3-[(E,15S)-15-hydroxy-15-[(2S,5R)-5-[(1R)-1-hydroxyundecyl]oxolan-2-yl]pentadec-9-en-11-ynyl]-5-methyl-3-phenylsulfanyloxolan-2-one |
| SMILES | CCCCCCCCCC[C@@H](O)[C@H]1CC[C@@H]([C@@H](O)CCC#C/C=C/CCCCCCCCC2(Sc3ccccc3)C[C@H](C)OC2=O)O1 |
| InChI | InChI=1S/C41H64O5S/c1-3-4-5-6-7-14-17-23-28-36(42)38-30-31-39(46-38)37(43)29-24-18-15-12-10-8-9-11-13-16-19-25-32-41(33-34(2)45-40(41)44)47-35-26-21-20-22-27-35/h10,12,20-22,26-27,34,36-39,42-43H,3-9,11,13-14,16-17,19,23-25,28-33H2,1-2H3/b12-10+/t34-,36+,37-,38+,39-,41?/m0/s1 |
| InChIKey | CWUDSJBNCZVZJN-MWECJEAGSA-N |
| XLogP | 10.11 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.03 |
| LogP ≤ 5 | 10.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|