C20H24BrClN2O4S — CID 100800177
N-(4-bromo-2,6-dimethylphenyl)-2-[4-(butylsulfamoyl)-2-chlorophenoxy]acetamide (PubChem CID 100800177) has the molecular formula C20H24BrClN2O4S and a molecular weight of 503.85 g/mol. Its IUPAC name is N-(4-bromo-2,6-dimethylphenyl)-2-[4-(butylsulfamoyl)-2-chlorophenoxy]acetamide.
| Compound Name | N-(4-bromo-2,6-dimethylphenyl)-2-[4-(butylsulfamoyl)-2-chlorophenoxy]acetamide |
|---|---|
| PubChem CID | 100800177 |
| Molecular Formula | C20H24BrClN2O4S |
| Molecular Weight | 503.85 g/mol |
| Exact Mass | 502.03 |
| IUPAC Name | N-(4-bromo-2,6-dimethylphenyl)-2-[4-(butylsulfamoyl)-2-chlorophenoxy]acetamide |
| SMILES | CCCCNS(=O)(=O)c1ccc(OCC(=O)Nc2c(C)cc(Br)cc2C)c(Cl)c1 |
| InChI | InChI=1S/C20H24BrClN2O4S/c1-4-5-8-23-29(26,27)16-6-7-18(17(22)11-16)28-12-19(25)24-20-13(2)9-15(21)10-14(20)3/h6-7,9-11,23H,4-5,8,12H2,1-3H3,(H,24,25) |
| InChIKey | DJGQODWVRWUECB-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.85 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|