C20H24BrClN2O4S — CID 28556470
N-[(1S)-1-(3-bromophenyl)ethyl]-2-[4-(butylsulfamoyl)-2-chlorophenoxy]acetamide (PubChem CID 28556470) has the molecular formula C20H24BrClN2O4S and a molecular weight of 503.85 g/mol. Its IUPAC name is N-[(1S)-1-(3-bromophenyl)ethyl]-2-[4-(butylsulfamoyl)-2-chlorophenoxy]acetamide.
| Compound Name | N-[(1S)-1-(3-bromophenyl)ethyl]-2-[4-(butylsulfamoyl)-2-chlorophenoxy]acetamide |
|---|---|
| PubChem CID | 28556470 |
| Molecular Formula | C20H24BrClN2O4S |
| Molecular Weight | 503.85 g/mol |
| Exact Mass | 502.03 |
| IUPAC Name | N-[(1S)-1-(3-bromophenyl)ethyl]-2-[4-(butylsulfamoyl)-2-chlorophenoxy]acetamide |
| SMILES | CCCCNS(=O)(=O)c1ccc(OCC(=O)N[C@@H](C)c2cccc(Br)c2)c(Cl)c1 |
| InChI | InChI=1S/C20H24BrClN2O4S/c1-3-4-10-23-29(26,27)17-8-9-19(18(22)12-17)28-13-20(25)24-14(2)15-6-5-7-16(21)11-15/h5-9,11-12,14,23H,3-4,10,13H2,1-2H3,(H,24,25)/t14-/m0/s1 |
| InChIKey | JEHHKMKGYXICLD-AWEZNQCLSA-N |
| XLogP | 4.44 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.85 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|